C24H25NO4 — CID 121447093
ethyl 2-[6-(6-cyclopentyloxy-2-pyridinyl)naphthalen-2-yl]oxyacetate (PubChem CID 121447093) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl 2-[6-(6-cyclopentyloxy-2-pyridinyl)naphthalen-2-yl]oxyacetate.
| Compound Name | ethyl 2-[6-(6-cyclopentyloxy-2-pyridinyl)naphthalen-2-yl]oxyacetate |
|---|---|
| PubChem CID | 121447093 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | ethyl 2-[6-(6-cyclopentyloxy-2-pyridinyl)naphthalen-2-yl]oxyacetate |
| SMILES | CCOC(=O)COc1ccc2cc(-c3cccc(OC4CCCC4)n3)ccc2c1 |
| InChI | InChI=1S/C24H25NO4/c1-2-27-24(26)16-28-21-13-12-17-14-19(11-10-18(17)15-21)22-8-5-9-23(25-22)29-20-6-3-4-7-20/h5,8-15,20H,2-4,6-7,16H2,1H3 |
| InChIKey | KVDVFLAYVQWTMQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |