C24H27NO3S — CID 121447242
ethyl 4-[6-(6-propan-2-ylsulfanyl-2-pyridinyl)naphthalen-2-yl]oxybutanoate (PubChem CID 121447242) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is ethyl 4-[6-(6-propan-2-ylsulfanyl-2-pyridinyl)naphthalen-2-yl]oxybutanoate.
| Compound Name | ethyl 4-[6-(6-propan-2-ylsulfanyl-2-pyridinyl)naphthalen-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 121447242 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | ethyl 4-[6-(6-propan-2-ylsulfanyl-2-pyridinyl)naphthalen-2-yl]oxybutanoate |
| SMILES | CCOC(=O)CCCOc1ccc2cc(-c3cccc(SC(C)C)n3)ccc2c1 |
| InChI | InChI=1S/C24H27NO3S/c1-4-27-24(26)9-6-14-28-21-13-12-18-15-20(11-10-19(18)16-21)22-7-5-8-23(25-22)29-17(2)3/h5,7-8,10-13,15-17H,4,6,9,14H2,1-3H3 |
| InChIKey | NUQIJUSLPHKABQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|