C27H27NO5S — CID 23659929
diethyl 2-[3-[6-(1,3-benzothiazol-2-yl)naphthalen-2-yl]oxypropyl]propanedioate (PubChem CID 23659929) has the molecular formula C27H27NO5S and a molecular weight of 477.58 g/mol. Its IUPAC name is diethyl 2-[3-[6-(1,3-benzothiazol-2-yl)naphthalen-2-yl]oxypropyl]propanedioate.
| Compound Name | diethyl 2-[3-[6-(1,3-benzothiazol-2-yl)naphthalen-2-yl]oxypropyl]propanedioate |
|---|---|
| PubChem CID | 23659929 |
| Molecular Formula | C27H27NO5S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | diethyl 2-[3-[6-(1,3-benzothiazol-2-yl)naphthalen-2-yl]oxypropyl]propanedioate |
| SMILES | CCOC(=O)C(CCCOc1ccc2cc(-c3nc4ccccc4s3)ccc2c1)C(=O)OCC |
| InChI | InChI=1S/C27H27NO5S/c1-3-31-26(29)22(27(30)32-4-2)8-7-15-33-21-14-13-18-16-20(12-11-19(18)17-21)25-28-23-9-5-6-10-24(23)34-25/h5-6,9-14,16-17,22H,3-4,7-8,15H2,1-2H3 |
| InChIKey | ADWOFCLYHJHVQS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|