C29H31NO5S — CID 142699943
ethyl (2S)-3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]phenyl]-2-ethoxypropanoate (PubChem CID 142699943) has the molecular formula C29H31NO5S and a molecular weight of 505.64 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]phenyl]-2-ethoxypropanoate.
| Compound Name | ethyl (2S)-3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]phenyl]-2-ethoxypropanoate |
|---|---|
| PubChem CID | 142699943 |
| Molecular Formula | C29H31NO5S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | ethyl (2S)-3-[4-[3-[4-(1,3-benzothiazol-2-yl)phenoxy]propoxy]phenyl]-2-ethoxypropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCCOc2ccc(-c3nc4ccccc4s3)cc2)cc1)OCC |
| InChI | InChI=1S/C29H31NO5S/c1-3-32-26(29(31)33-4-2)20-21-10-14-23(15-11-21)34-18-7-19-35-24-16-12-22(13-17-24)28-30-25-8-5-6-9-27(25)36-28/h5-6,8-17,26H,3-4,7,18-20H2,1-2H3/t26-/m0/s1 |
| InChIKey | NMCLLTQICLAIOS-SANMLTNESA-N |
| XLogP | 6.32 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|