C20H19NO2S — CID 102454644
butyl (E)-3-[4-(1,3-benzothiazol-2-yl)phenyl]prop-2-enoate (PubChem CID 102454644) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is butyl (E)-3-[4-(1,3-benzothiazol-2-yl)phenyl]prop-2-enoate.
| Compound Name | butyl (E)-3-[4-(1,3-benzothiazol-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 102454644 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | butyl (E)-3-[4-(1,3-benzothiazol-2-yl)phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)/C=C/c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H19NO2S/c1-2-3-14-23-19(22)13-10-15-8-11-16(12-9-15)20-21-17-6-4-5-7-18(17)24-20/h4-13H,2-3,14H2,1H3/b13-10+ |
| InChIKey | CRGWCLZYSCAPMK-JLHYYAGUSA-N |
| XLogP | 5.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|