C44H59O12P — CID 154199339
butyl 3-[4-[3-[6-[6-[3-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]prop-2-enoyloxy]hexoxy-hydroxyphosphoryl]oxyhexoxy]-3-oxoprop-1-enyl]phenyl]prop-2-enoate (PubChem CID 154199339) has the molecular formula C44H59O12P and a molecular weight of 810.92 g/mol. Its IUPAC name is butyl 3-[4-[3-[6-[6-[3-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]prop-2-enoyloxy]hexoxy-hydroxyphosphoryl]oxyhexoxy]-3-oxoprop-1-enyl]phenyl]prop-2-enoate.
| Compound Name | butyl 3-[4-[3-[6-[6-[3-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]prop-2-enoyloxy]hexoxy-hydroxyphosphoryl]oxyhexoxy]-3-oxoprop-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 154199339 |
| Molecular Formula | C44H59O12P |
| Molecular Weight | 810.92 g/mol |
| Exact Mass | 810.37 |
| IUPAC Name | butyl 3-[4-[3-[6-[6-[3-[4-(3-butoxy-3-oxoprop-1-enyl)phenyl]prop-2-enoyloxy]hexoxy-hydroxyphosphoryl]oxyhexoxy]-3-oxoprop-1-enyl]phenyl]prop-2-enoate |
| SMILES | CCCCOC(=O)C=Cc1ccc(C=CC(=O)OCCCCCCOP(=O)(O)OCCCCCCOC(=O)C=Cc2ccc(C=CC(=O)OCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H59O12P/c1-3-5-31-51-41(45)27-23-37-15-19-39(20-16-37)25-29-43(47)53-33-11-7-9-13-35-55-57(49,50)56-36-14-10-8-12-34-54-44(48)30-26-40-21-17-38(18-22-40)24-28-42(46)52-32-6-4-2/h15-30H,3-14,31-36H2,1-2H3,(H,49,50) |
| InChIKey | LZARMOULXDYWOZ-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.92 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|