C22H23NO3S — CID 121446981
4-[6-(2-propan-2-ylsulfanyl-3-pyridinyl)naphthalen-2-yl]oxybutanoic acid (PubChem CID 121446981) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 4-[6-(2-propan-2-ylsulfanyl-3-pyridinyl)naphthalen-2-yl]oxybutanoic acid.
| Compound Name | 4-[6-(2-propan-2-ylsulfanyl-3-pyridinyl)naphthalen-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 121446981 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-[6-(2-propan-2-ylsulfanyl-3-pyridinyl)naphthalen-2-yl]oxybutanoic acid |
| SMILES | CC(C)Sc1ncccc1-c1ccc2cc(OCCCC(=O)O)ccc2c1 |
| InChI | InChI=1S/C22H23NO3S/c1-15(2)27-22-20(5-3-11-23-22)18-8-7-17-14-19(10-9-16(17)13-18)26-12-4-6-21(24)25/h3,5,7-11,13-15H,4,6,12H2,1-2H3,(H,24,25) |
| InChIKey | QPBZUDFEXALLHM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|