C19H23NO2S — CID 163935182
5-[4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]pent-1-en-2-ol (PubChem CID 163935182) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 5-[4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]pent-1-en-2-ol.
| Compound Name | 5-[4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]pent-1-en-2-ol |
|---|---|
| PubChem CID | 163935182 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 5-[4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]pent-1-en-2-ol |
| SMILES | C=C(O)CCCOc1ccc(-c2cccc(SC(C)C)n2)cc1 |
| InChI | InChI=1S/C19H23NO2S/c1-14(2)23-19-8-4-7-18(20-19)16-9-11-17(12-10-16)22-13-5-6-15(3)21/h4,7-12,14,21H,3,5-6,13H2,1-2H3 |
| InChIKey | RMDBTKBQSRDWFN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|