C21H21N3O3 — CID 174458677
4-[4-(5-amino-6-benzylpyrazin-2-yl)phenoxy]butanoic acid (PubChem CID 174458677) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[4-(5-amino-6-benzylpyrazin-2-yl)phenoxy]butanoic acid.
| Compound Name | 4-[4-(5-amino-6-benzylpyrazin-2-yl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 174458677 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[4-(5-amino-6-benzylpyrazin-2-yl)phenoxy]butanoic acid |
| SMILES | Nc1ncc(-c2ccc(OCCCC(=O)O)cc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C21H21N3O3/c22-21-18(13-15-5-2-1-3-6-15)24-19(14-23-21)16-8-10-17(11-9-16)27-12-4-7-20(25)26/h1-3,5-6,8-11,14H,4,7,12-13H2,(H2,22,23)(H,25,26) |
| InChIKey | UUEUOOYUCBHTPI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|