C20H23N3O — CID 153387650
3-benzyl-5-(4-methoxyphenyl)pyrazin-2-amine;ethane (PubChem CID 153387650) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-benzyl-5-(4-methoxyphenyl)pyrazin-2-amine;ethane.
| Compound Name | 3-benzyl-5-(4-methoxyphenyl)pyrazin-2-amine;ethane |
|---|---|
| PubChem CID | 153387650 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 3-benzyl-5-(4-methoxyphenyl)pyrazin-2-amine;ethane |
| SMILES | CC.COc1ccc(-c2cnc(N)c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H17N3O.C2H6/c1-22-15-9-7-14(8-10-15)17-12-20-18(19)16(21-17)11-13-5-3-2-4-6-13;1-2/h2-10,12H,11H2,1H3,(H2,19,20);1-2H3 |
| InChIKey | VTOVNOMHVLIEOG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |