4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid

C14H17NO4 — CID 117098155

IUPAC4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid
SMILESCC(C)c1nc2cc(OCCCC(=O)O)ccc2o1
InChIInChI=1S/C14H17NO4/c1-9(2)14-15-11-8-10(5-6-12(11)19-14)18-7-3-4-13(16)17/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,17)
InChIKeyRCOLQUQLBSONCP-UHFFFAOYSA-N
MW263.29 g/mol
LogP3.19
Rot. Bonds6

About 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid

4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid (PubChem CID 117098155) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid.

Molecular Properties

Compound Name4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid
PubChem CID117098155
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid
SMILESCC(C)c1nc2cc(OCCCC(=O)O)ccc2o1
InChIInChI=1S/C14H17NO4/c1-9(2)14-15-11-8-10(5-6-12(11)19-14)18-7-3-4-13(16)17/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,17)
InChIKeyRCOLQUQLBSONCP-UHFFFAOYSA-N
XLogP3.19
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 53.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid?
The IUPAC name of 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid (CID 117098155) is 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid.
What is the SMILES notation for 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid?
The canonical SMILES for 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid is CC(C)c1nc2cc(OCCCC(=O)O)ccc2o1.
What is the InChIKey of 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid?
The InChIKey is RCOLQUQLBSONCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-9(2)14-15-11-8-10(5-6-12(11)19-14)18-7-3-4-13(16)17/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,17).
What are the key properties of 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid?
4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid has a molecular weight of 263.29 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-propan-2-yl-1,3-benzoxazol-5-yl)oxy]butanoic acid is sourced from PubChem (CID 117098155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).