C18H15NO5 — CID 15288359
3-(3-carboxypropoxy)acridine-9-carboxylic acid (PubChem CID 15288359) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 3-(3-carboxypropoxy)acridine-9-carboxylic acid.
| Compound Name | 3-(3-carboxypropoxy)acridine-9-carboxylic acid |
|---|---|
| PubChem CID | 15288359 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-(3-carboxypropoxy)acridine-9-carboxylic acid |
| SMILES | O=C(O)CCCOc1ccc2c(C(=O)O)c3ccccc3nc2c1 |
| InChI | InChI=1S/C18H15NO5/c20-16(21)6-3-9-24-11-7-8-13-15(10-11)19-14-5-2-1-4-12(14)17(13)18(22)23/h1-2,4-5,7-8,10H,3,6,9H2,(H,20,21)(H,22,23) |
| InChIKey | NUTREAPKSXDBEL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|