C36H26O8 — CID 100913585
4-[[18-(3-carboxypropoxy)-13,26-dioxo-5-heptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(27),2,4,6,8,10(28),11,14,16(21),17,19,22,24-tridecaenyl]oxy]butanoic acid (PubChem CID 100913585) has the molecular formula C36H26O8 and a molecular weight of 586.60 g/mol. Its IUPAC name is 4-[[18-(3-carboxypropoxy)-13,26-dioxo-5-heptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(27),2,4,6,8,10(28),11,14,16(21),17,19,22,24-tridecaenyl]oxy]butanoic acid.
| Compound Name | 4-[[18-(3-carboxypropoxy)-13,26-dioxo-5-heptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(27),2,4,6,8,10(28),11,14,16(21),17,19,22,24-tridecaenyl]oxy]butanoic acid |
|---|---|
| PubChem CID | 100913585 |
| Molecular Formula | C36H26O8 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 4-[[18-(3-carboxypropoxy)-13,26-dioxo-5-heptacyclo[13.11.1.12,10.03,8.016,21.023,27.014,28]octacosa-1(27),2,4,6,8,10(28),11,14,16(21),17,19,22,24-tridecaenyl]oxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc2cc3ccc(=O)c4c3c(c2c1)c1c(=O)ccc2cc3ccc(OCCCC(=O)O)cc3c4c21 |
| InChI | InChI=1S/C36H26O8/c37-27-11-8-22-16-20-6-10-24(44-14-2-4-30(41)42)18-26(20)34-32(22)35(27)33-25-17-23(43-13-1-3-29(39)40)9-5-19(25)15-21-7-12-28(38)36(34)31(21)33/h5-12,15-18H,1-4,13-14H2,(H,39,40)(H,41,42) |
| InChIKey | WJEZUUBPWLONHJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|