C24H29NO8 — CID 59283816
2,7-bis[2-(2-methoxyethoxy)ethoxy]acridine-9-carboxylic acid (PubChem CID 59283816) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2,7-bis[2-(2-methoxyethoxy)ethoxy]acridine-9-carboxylic acid.
| Compound Name | 2,7-bis[2-(2-methoxyethoxy)ethoxy]acridine-9-carboxylic acid |
|---|---|
| PubChem CID | 59283816 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2,7-bis[2-(2-methoxyethoxy)ethoxy]acridine-9-carboxylic acid |
| SMILES | COCCOCCOc1ccc2nc3ccc(OCCOCCOC)cc3c(C(=O)O)c2c1 |
| InChI | InChI=1S/C24H29NO8/c1-28-7-9-30-11-13-32-17-3-5-21-19(15-17)23(24(26)27)20-16-18(4-6-22(20)25-21)33-14-12-31-10-8-29-2/h3-6,15-16H,7-14H2,1-2H3,(H,26,27) |
| InChIKey | CSJSCLRLNUFJFC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|