C12H13ClN2O3 — CID 156870415
2-(chloromethyl)-6-(2-methoxyethoxy)-3H-quinazolin-4-one (PubChem CID 156870415) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(2-methoxyethoxy)-3H-quinazolin-4-one.
| Compound Name | 2-(chloromethyl)-6-(2-methoxyethoxy)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 156870415 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-(chloromethyl)-6-(2-methoxyethoxy)-3H-quinazolin-4-one |
| SMILES | COCCOc1ccc2nc(CCl)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C12H13ClN2O3/c1-17-4-5-18-8-2-3-10-9(6-8)12(16)15-11(7-13)14-10/h2-3,6H,4-5,7H2,1H3,(H,14,15,16) |
| InChIKey | NMJVJMRZMSYEEI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|