C11H10F2N2O2 — CID 143751543
6-(difluoromethoxy)-2-ethyl-3H-quinazolin-4-one (PubChem CID 143751543) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2-ethyl-3H-quinazolin-4-one.
| Compound Name | 6-(difluoromethoxy)-2-ethyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 143751543 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 6-(difluoromethoxy)-2-ethyl-3H-quinazolin-4-one |
| SMILES | CCc1nc2ccc(OC(F)F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H10F2N2O2/c1-2-9-14-8-4-3-6(17-11(12)13)5-7(8)10(16)15-9/h3-5,11H,2H2,1H3,(H,14,15,16) |
| InChIKey | KGGQZCCYABGMRP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |