C13H15F3N2O2 — CID 144970353
ethane;2-ethyl-6-(trifluoromethoxy)-3H-quinazolin-4-one (PubChem CID 144970353) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is ethane;2-ethyl-6-(trifluoromethoxy)-3H-quinazolin-4-one.
| Compound Name | ethane;2-ethyl-6-(trifluoromethoxy)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 144970353 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | ethane;2-ethyl-6-(trifluoromethoxy)-3H-quinazolin-4-one |
| SMILES | CC.CCc1nc2ccc(OC(F)(F)F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H9F3N2O2.C2H6/c1-2-9-15-8-4-3-6(18-11(12,13)14)5-7(8)10(17)16-9;1-2/h3-5H,2H2,1H3,(H,15,16,17);1-2H3 |
| InChIKey | LVBPQTIEZOTJBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |