C19H14F3NO3 — CID 4303527
2-(4-ethylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid (PubChem CID 4303527) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid.
| Compound Name | 2-(4-ethylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4303527 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-(4-ethylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
| SMILES | CCc1ccc(-c2cc(C(=O)O)c3cc(OC(F)(F)F)ccc3n2)cc1 |
| InChI | InChI=1S/C19H14F3NO3/c1-2-11-3-5-12(6-4-11)17-10-15(18(24)25)14-9-13(26-19(20,21)22)7-8-16(14)23-17/h3-10H,2H2,1H3,(H,24,25) |
| InChIKey | RHKINDKQLGEYKS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |