C17H9ClF3NO3 — CID 3536626
2-(3-chlorophenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid (PubChem CID 3536626) has the molecular formula C17H9ClF3NO3 and a molecular weight of 367.71 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid.
| Compound Name | 2-(3-chlorophenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3536626 |
| Molecular Formula | C17H9ClF3NO3 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 2-(3-chlorophenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc(Cl)c2)nc2ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C17H9ClF3NO3/c18-10-3-1-2-9(6-10)15-8-13(16(23)24)12-7-11(25-17(19,20)21)4-5-14(12)22-15/h1-8H,(H,23,24) |
| InChIKey | LQFYIDCGYQACIW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |