C18H12F3NO4 — CID 18073526
7-methoxy-2-[4-(trifluoromethoxy)phenyl]quinoline-4-carboxylic acid (PubChem CID 18073526) has the molecular formula C18H12F3NO4 and a molecular weight of 363.29 g/mol. Its IUPAC name is 7-methoxy-2-[4-(trifluoromethoxy)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 7-methoxy-2-[4-(trifluoromethoxy)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 18073526 |
| Molecular Formula | C18H12F3NO4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 7-methoxy-2-[4-(trifluoromethoxy)phenyl]quinoline-4-carboxylic acid |
| SMILES | COc1ccc2c(C(=O)O)cc(-c3ccc(OC(F)(F)F)cc3)nc2c1 |
| InChI | InChI=1S/C18H12F3NO4/c1-25-12-6-7-13-14(17(23)24)9-15(22-16(13)8-12)10-2-4-11(5-3-10)26-18(19,20)21/h2-9H,1H3,(H,23,24) |
| InChIKey | AMPVAZFSFORAEY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |