C16H10F3NO3S — CID 3918730
2-(5-methylthiophen-2-yl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid (PubChem CID 3918730) has the molecular formula C16H10F3NO3S and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid.
| Compound Name | 2-(5-methylthiophen-2-yl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3918730 |
| Molecular Formula | C16H10F3NO3S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)O)c3cc(OC(F)(F)F)ccc3n2)s1 |
| InChI | InChI=1S/C16H10F3NO3S/c1-8-2-5-14(24-8)13-7-11(15(21)22)10-6-9(23-16(17,18)19)3-4-12(10)20-13/h2-7H,1H3,(H,21,22) |
| InChIKey | MFPRNMNFWRWIGT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |