C15H10BrNO2S — CID 29041657
5-bromo-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid (PubChem CID 29041657) has the molecular formula C15H10BrNO2S and a molecular weight of 348.22 g/mol. Its IUPAC name is 5-bromo-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid.
| Compound Name | 5-bromo-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 29041657 |
| Molecular Formula | C15H10BrNO2S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 5-bromo-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)O)c3c(Br)cccc3n2)s1 |
| InChI | InChI=1S/C15H10BrNO2S/c1-8-5-6-13(20-8)12-7-9(15(18)19)14-10(16)3-2-4-11(14)17-12/h2-7H,1H3,(H,18,19) |
| InChIKey | SPWYONAMDYPJBD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |