C12H9F3N2O3 — CID 82574511
N-hydroxy-2-methyl-6-(trifluoromethoxy)quinoline-4-carboxamide (PubChem CID 82574511) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is N-hydroxy-2-methyl-6-(trifluoromethoxy)quinoline-4-carboxamide.
| Compound Name | N-hydroxy-2-methyl-6-(trifluoromethoxy)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 82574511 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-hydroxy-2-methyl-6-(trifluoromethoxy)quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NO)c2cc(OC(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C12H9F3N2O3/c1-6-4-9(11(18)17-19)8-5-7(20-12(13,14)15)2-3-10(8)16-6/h2-5,19H,1H3,(H,17,18) |
| InChIKey | XRKAHMVWQYOZOZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|