C18H12F3NO3 — CID 4272780
2-(3-methylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid (PubChem CID 4272780) has the molecular formula C18H12F3NO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is 2-(3-methylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid.
| Compound Name | 2-(3-methylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4272780 |
| Molecular Formula | C18H12F3NO3 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-(3-methylphenyl)-6-(trifluoromethoxy)quinoline-4-carboxylic acid |
| SMILES | Cc1cccc(-c2cc(C(=O)O)c3cc(OC(F)(F)F)ccc3n2)c1 |
| InChI | InChI=1S/C18H12F3NO3/c1-10-3-2-4-11(7-10)16-9-14(17(23)24)13-8-12(25-18(19,20)21)5-6-15(13)22-16/h2-9H,1H3,(H,23,24) |
| InChIKey | JOKMXYTVSNYKFB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |