C39H28Cl2F6N2O3 — CID 150638011
2,4-bis[4-(3-chlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]pentan-3-one (PubChem CID 150638011) has the molecular formula C39H28Cl2F6N2O3 and a molecular weight of 757.56 g/mol. Its IUPAC name is 2,4-bis[4-(3-chlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]pentan-3-one.
| Compound Name | 2,4-bis[4-(3-chlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]pentan-3-one |
|---|---|
| PubChem CID | 150638011 |
| Molecular Formula | C39H28Cl2F6N2O3 |
| Molecular Weight | 757.56 g/mol |
| Exact Mass | 756.14 |
| IUPAC Name | 2,4-bis[4-(3-chlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]pentan-3-one |
| SMILES | Cc1nc2ccc(OC(F)(F)F)cc2c(-c2cccc(Cl)c2)c1C(C)C(=O)C(C)c1c(C)nc2ccc(OC(F)(F)F)cc2c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C39H28Cl2F6N2O3/c1-19(33-21(3)48-31-13-11-27(51-38(42,43)44)17-29(31)35(33)23-7-5-9-25(40)15-23)37(50)20(2)34-22(4)49-32-14-12-28(52-39(45,46)47)18-30(32)36(34)24-8-6-10-26(41)16-24/h5-20H,1-4H3 |
| InChIKey | IZHLKOHMGVVMHM-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.56 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |