C19H12Cl2F3NO2 — CID 87791790
2-[4-(3,4-dichlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]acetaldehyde (PubChem CID 87791790) has the molecular formula C19H12Cl2F3NO2 and a molecular weight of 414.21 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]acetaldehyde.
| Compound Name | 2-[4-(3,4-dichlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 87791790 |
| Molecular Formula | C19H12Cl2F3NO2 |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-2-methyl-6-(trifluoromethoxy)quinolin-3-yl]acetaldehyde |
| SMILES | Cc1nc2ccc(OC(F)(F)F)cc2c(-c2ccc(Cl)c(Cl)c2)c1CC=O |
| InChI | InChI=1S/C19H12Cl2F3NO2/c1-10-13(6-7-26)18(11-2-4-15(20)16(21)8-11)14-9-12(27-19(22,23)24)3-5-17(14)25-10/h2-5,7-9H,6H2,1H3 |
| InChIKey | DHUFJVOOZFYLPA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|