About 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane
3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane (PubChem CID 144781134) has the molecular formula C16H17F3N2O
and a molecular weight of 310.32 g/mol. Its IUPAC name is 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane.
Molecular Properties
| Compound Name | 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane |
| PubChem CID | 144781134 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane |
| SMILES | CC.Cc1c[nH]c2c1c(C)nc1ccc(OC(F)(F)F)cc12 |
| InChI | InChI=1S/C14H11F3N2O.C2H6/c1-7-6-18-13-10-5-9(20-14(15,16)17)3-4-11(10)19-8(2)12(7)13;1-2/h3-6,18H,1-2H3;1-2H3 |
| InChIKey | WVVOQGRWZFBDPE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane?
The IUPAC name of 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane (CID 144781134) is 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane.
What is the SMILES notation for 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane?
The canonical SMILES for 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane is CC.Cc1c[nH]c2c1c(C)nc1ccc(OC(F)(F)F)cc12.
What is the InChIKey of 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane?
The InChIKey is WVVOQGRWZFBDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3N2O.C2H6/c1-7-6-18-13-10-5-9(20-14(15,16)17)3-4-11(10)19-8(2)12(7)13;1-2/h3-6,18H,1-2H3;1-2H3.
What are the key properties of 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane?
3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane has a molecular weight of 310.32 g/mol, XLogP of 5.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-8-(trifluoromethoxy)-1H-pyrrolo[3,2-c]quinoline;ethane is sourced from PubChem (CID 144781134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).