C20H16F3NO3 — CID 2135923
ethyl 2-methyl-4-phenyl-6-(trifluoromethoxy)quinoline-3-carboxylate (PubChem CID 2135923) has the molecular formula C20H16F3NO3 and a molecular weight of 375.35 g/mol. Its IUPAC name is ethyl 2-methyl-4-phenyl-6-(trifluoromethoxy)quinoline-3-carboxylate.
| Compound Name | ethyl 2-methyl-4-phenyl-6-(trifluoromethoxy)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 2135923 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 2-methyl-4-phenyl-6-(trifluoromethoxy)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2ccc(OC(F)(F)F)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C20H16F3NO3/c1-3-26-19(25)17-12(2)24-16-10-9-14(27-20(21,22)23)11-15(16)18(17)13-7-5-4-6-8-13/h4-11H,3H2,1-2H3 |
| InChIKey | XLAYFTRDTMJWRX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |