C20H17F2NO3 — CID 164677018
ethyl 2,2-difluoro-2-(6-methoxy-4-phenylquinolin-3-yl)acetate (PubChem CID 164677018) has the molecular formula C20H17F2NO3 and a molecular weight of 357.36 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(6-methoxy-4-phenylquinolin-3-yl)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(6-methoxy-4-phenylquinolin-3-yl)acetate |
|---|---|
| PubChem CID | 164677018 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | ethyl 2,2-difluoro-2-(6-methoxy-4-phenylquinolin-3-yl)acetate |
| SMILES | CCOC(=O)C(F)(F)c1cnc2ccc(OC)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C20H17F2NO3/c1-3-26-19(24)20(21,22)16-12-23-17-10-9-14(25-2)11-15(17)18(16)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3 |
| InChIKey | LGEQBJRSQKFMCS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |