C8H6Cl2F2N2O2 — CID 163409906
ethyl 2-(2,4-dichloropyrimidin-5-yl)-2,2-difluoroacetate (PubChem CID 163409906) has the molecular formula C8H6Cl2F2N2O2 and a molecular weight of 271.05 g/mol. Its IUPAC name is ethyl 2-(2,4-dichloropyrimidin-5-yl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(2,4-dichloropyrimidin-5-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 163409906 |
| Molecular Formula | C8H6Cl2F2N2O2 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | ethyl 2-(2,4-dichloropyrimidin-5-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C8H6Cl2F2N2O2/c1-2-16-6(15)8(11,12)4-3-13-7(10)14-5(4)9/h3H,2H2,1H3 |
| InChIKey | AIJOAUVWBWPNNK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |