C11H15ClN2O5S — CID 176916292
ethyl 2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-3-hydroxy-2-methylpropanoate (PubChem CID 176916292) has the molecular formula C11H15ClN2O5S and a molecular weight of 322.77 g/mol. Its IUPAC name is ethyl 2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-3-hydroxy-2-methylpropanoate.
| Compound Name | ethyl 2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 176916292 |
| Molecular Formula | C11H15ClN2O5S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | ethyl 2-(4-chloro-2-methylsulfonylpyrimidin-5-yl)-3-hydroxy-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(CO)c1cnc(S(C)(=O)=O)nc1Cl |
| InChI | InChI=1S/C11H15ClN2O5S/c1-4-19-9(16)11(2,6-15)7-5-13-10(14-8(7)12)20(3,17)18/h5,15H,4,6H2,1-3H3 |
| InChIKey | PIFZLDRVAHCUNO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |