About ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate
ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate (PubChem CID 153323974) has the molecular formula C9H9BrF2N2O2
and a molecular weight of 295.08 g/mol. Its IUPAC name is ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate.
Analyze ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate?
The IUPAC name of ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate (CID 153323974) is ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate is CCOC(=O)C(F)(F)c1ncc(Br)c(C)n1.
What is the InChIKey of ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate?
The InChIKey is QZHCDWVZKAUDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrF2N2O2/c1-3-16-8(15)9(11,12)7-13-4-6(10)5(2)14-7/h4H,3H2,1-2H3.
What are the key properties of ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate?
ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate has a molecular weight of 295.08 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-bromo-4-methylpyrimidin-2-yl)-2,2-difluoroacetate is sourced from PubChem (CID 153323974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).