C9H8F3NO2 — CID 170947614
ethyl 2,2-difluoro-2-(2-fluoro-4-pyridinyl)acetate (PubChem CID 170947614) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(2-fluoro-4-pyridinyl)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(2-fluoro-4-pyridinyl)acetate |
|---|---|
| PubChem CID | 170947614 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | ethyl 2,2-difluoro-2-(2-fluoro-4-pyridinyl)acetate |
| SMILES | CCOC(=O)C(F)(F)c1ccnc(F)c1 |
| InChI | InChI=1S/C9H8F3NO2/c1-2-15-8(14)9(11,12)6-3-4-13-7(10)5-6/h3-5H,2H2,1H3 |
| InChIKey | MKLXCFNISGZMCK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|