C9H11FN2O2 — CID 55270877
(3R)-3-amino-3-(2-fluoro-4-pyridinyl)butanoic acid (PubChem CID 55270877) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is (3R)-3-amino-3-(2-fluoro-4-pyridinyl)butanoic acid.
| Compound Name | (3R)-3-amino-3-(2-fluoro-4-pyridinyl)butanoic acid |
|---|---|
| PubChem CID | 55270877 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (3R)-3-amino-3-(2-fluoro-4-pyridinyl)butanoic acid |
| SMILES | C[C@@](N)(CC(=O)O)c1ccnc(F)c1 |
| InChI | InChI=1S/C9H11FN2O2/c1-9(11,5-8(13)14)6-2-3-12-7(10)4-6/h2-4H,5,11H2,1H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | GLLBYVVKLRLLOC-SECBINFHSA-N |
| XLogP | 0.87 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|