C14H12F2N2O2 — CID 162398710
ethyl 2,2-difluoro-2-(3-pyrimidin-2-ylphenyl)acetate (PubChem CID 162398710) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(3-pyrimidin-2-ylphenyl)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(3-pyrimidin-2-ylphenyl)acetate |
|---|---|
| PubChem CID | 162398710 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | ethyl 2,2-difluoro-2-(3-pyrimidin-2-ylphenyl)acetate |
| SMILES | CCOC(=O)C(F)(F)c1cccc(-c2ncccn2)c1 |
| InChI | InChI=1S/C14H12F2N2O2/c1-2-20-13(19)14(15,16)11-6-3-5-10(9-11)12-17-7-4-8-18-12/h3-9H,2H2,1H3 |
| InChIKey | MQUSBVZRXQJDDV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |