C8H7BrF2O2S — CID 166132555
ethyl 2-(4-bromothiophen-2-yl)-2,2-difluoroacetate (PubChem CID 166132555) has the molecular formula C8H7BrF2O2S and a molecular weight of 285.11 g/mol. Its IUPAC name is ethyl 2-(4-bromothiophen-2-yl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-bromothiophen-2-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 166132555 |
| Molecular Formula | C8H7BrF2O2S |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | ethyl 2-(4-bromothiophen-2-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cc(Br)cs1 |
| InChI | InChI=1S/C8H7BrF2O2S/c1-2-13-7(12)8(10,11)6-3-5(9)4-14-6/h3-4H,2H2,1H3 |
| InChIKey | VFICZEGJFSUBGH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |