C12H14BrF2NO2 — CID 102258948
ethyl 2-[5-bromo-2-(dimethylamino)phenyl]-2,2-difluoroacetate (PubChem CID 102258948) has the molecular formula C12H14BrF2NO2 and a molecular weight of 322.15 g/mol. Its IUPAC name is ethyl 2-[5-bromo-2-(dimethylamino)phenyl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[5-bromo-2-(dimethylamino)phenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 102258948 |
| Molecular Formula | C12H14BrF2NO2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | ethyl 2-[5-bromo-2-(dimethylamino)phenyl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cc(Br)ccc1N(C)C |
| InChI | InChI=1S/C12H14BrF2NO2/c1-4-18-11(17)12(14,15)9-7-8(13)5-6-10(9)16(2)3/h5-7H,4H2,1-3H3 |
| InChIKey | ICZZLYYALIXYBD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |