C9H8BrF2NO3 — CID 164901022
ethyl 2-(4-bromo-1-oxidopyridin-1-ium-2-yl)-2,2-difluoroacetate (PubChem CID 164901022) has the molecular formula C9H8BrF2NO3 and a molecular weight of 296.07 g/mol. Its IUPAC name is ethyl 2-(4-bromo-1-oxidopyridin-1-ium-2-yl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-bromo-1-oxidopyridin-1-ium-2-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 164901022 |
| Molecular Formula | C9H8BrF2NO3 |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | ethyl 2-(4-bromo-1-oxidopyridin-1-ium-2-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cc(Br)cc[n+]1[O-] |
| InChI | InChI=1S/C9H8BrF2NO3/c1-2-16-8(14)9(11,12)7-5-6(10)3-4-13(7)15/h3-5H,2H2,1H3 |
| InChIKey | GOAURAINSHGDFS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|