C8H6BrF2NO4S — CID 165451566
ethyl 2-(5-bromo-4-nitrothiophen-2-yl)-2,2-difluoroacetate (PubChem CID 165451566) has the molecular formula C8H6BrF2NO4S and a molecular weight of 330.11 g/mol. Its IUPAC name is ethyl 2-(5-bromo-4-nitrothiophen-2-yl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(5-bromo-4-nitrothiophen-2-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 165451566 |
| Molecular Formula | C8H6BrF2NO4S |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | ethyl 2-(5-bromo-4-nitrothiophen-2-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1cc([N+](=O)[O-])c(Br)s1 |
| InChI | InChI=1S/C8H6BrF2NO4S/c1-2-16-7(13)8(10,11)5-3-4(12(14)15)6(9)17-5/h3H,2H2,1H3 |
| InChIKey | SSEHZWGBAGAGEN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|