C22H15F3N2O — CID 102531409
3,4-diphenyl-6-(trifluoromethoxy)quinolin-2-amine (PubChem CID 102531409) has the molecular formula C22H15F3N2O and a molecular weight of 380.37 g/mol. Its IUPAC name is 3,4-diphenyl-6-(trifluoromethoxy)quinolin-2-amine.
| Compound Name | 3,4-diphenyl-6-(trifluoromethoxy)quinolin-2-amine |
|---|---|
| PubChem CID | 102531409 |
| Molecular Formula | C22H15F3N2O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3,4-diphenyl-6-(trifluoromethoxy)quinolin-2-amine |
| SMILES | Nc1nc2ccc(OC(F)(F)F)cc2c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H15F3N2O/c23-22(24,25)28-16-11-12-18-17(13-16)19(14-7-3-1-4-8-14)20(21(26)27-18)15-9-5-2-6-10-15/h1-13H,(H2,26,27) |
| InChIKey | MICCWYXLGIWNPC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |