C48H30F6N2O2 — CID 155140916
2-[4-[3,5-bis[4-(trifluoromethoxy)phenyl]phenyl]phenyl]-4,5,6-triphenylpyrimidine (PubChem CID 155140916) has the molecular formula C48H30F6N2O2 and a molecular weight of 780.77 g/mol. Its IUPAC name is 2-[4-[3,5-bis[4-(trifluoromethoxy)phenyl]phenyl]phenyl]-4,5,6-triphenylpyrimidine.
| Compound Name | 2-[4-[3,5-bis[4-(trifluoromethoxy)phenyl]phenyl]phenyl]-4,5,6-triphenylpyrimidine |
|---|---|
| PubChem CID | 155140916 |
| Molecular Formula | C48H30F6N2O2 |
| Molecular Weight | 780.77 g/mol |
| Exact Mass | 780.22 |
| IUPAC Name | 2-[4-[3,5-bis[4-(trifluoromethoxy)phenyl]phenyl]phenyl]-4,5,6-triphenylpyrimidine |
| SMILES | FC(F)(F)Oc1ccc(-c2cc(-c3ccc(OC(F)(F)F)cc3)cc(-c3ccc(-c4nc(-c5ccccc5)c(-c5ccccc5)c(-c5ccccc5)n4)cc3)c2)cc1 |
| InChI | InChI=1S/C48H30F6N2O2/c49-47(50,51)57-41-24-20-32(21-25-41)39-28-38(29-40(30-39)33-22-26-42(27-23-33)58-48(52,53)54)31-16-18-37(19-17-31)46-55-44(35-12-6-2-7-13-35)43(34-10-4-1-5-11-34)45(56-46)36-14-8-3-9-15-36/h1-30H |
| InChIKey | HYTSWIWBBZGIBE-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.77 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |