C29H21F3N4O — CID 3507207
N-benzyl-2-phenyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-amine (PubChem CID 3507207) has the molecular formula C29H21F3N4O and a molecular weight of 498.51 g/mol. Its IUPAC name is N-benzyl-2-phenyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-amine.
| Compound Name | N-benzyl-2-phenyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3507207 |
| Molecular Formula | C29H21F3N4O |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-benzyl-2-phenyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)Oc1ccc(-c2cncc(-c3cc(NCc4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C29H21F3N4O/c30-29(31,32)37-25-13-11-21(12-14-25)23-15-24(19-33-18-23)26-16-27(34-17-20-7-3-1-4-8-20)36-28(35-26)22-9-5-2-6-10-22/h1-16,18-19H,17H2,(H,34,35,36) |
| InChIKey | SZRKACBEVSDFKF-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |