C24H20F3N5O — CID 101255631
2-N,4-N-dibenzyl-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 101255631) has the molecular formula C24H20F3N5O and a molecular weight of 451.45 g/mol. Its IUPAC name is 2-N,4-N-dibenzyl-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibenzyl-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 101255631 |
| Molecular Formula | C24H20F3N5O |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-N,4-N-dibenzyl-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)Oc1ccc(-c2nc(NCc3ccccc3)nc(NCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H20F3N5O/c25-24(26,27)33-20-13-11-19(12-14-20)21-30-22(28-15-17-7-3-1-4-8-17)32-23(31-21)29-16-18-9-5-2-6-10-18/h1-14H,15-16H2,(H2,28,29,30,31,32) |
| InChIKey | YKHLQMWHKAGPEX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |