About benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine
benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 159253031) has the molecular formula C15H18F3N3O
and a molecular weight of 313.32 g/mol. Its IUPAC name is benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine.
Molecular Properties
| Compound Name | benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine |
| PubChem CID | 159253031 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | NCc1ccc(OC(F)(F)F)cc1.NNCc1ccccc1 |
| InChI | InChI=1S/C8H8F3NO.C7H10N2/c9-8(10,11)13-7-3-1-6(5-12)2-4-7;8-9-6-7-4-2-1-3-5-7/h1-4H,5,12H2;1-5,9H,6,8H2 |
| InChIKey | KVNUKTRFHQOCNM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine?
The IUPAC name of benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine (CID 159253031) is benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine.
What is the SMILES notation for benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine?
The canonical SMILES for benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine is NCc1ccc(OC(F)(F)F)cc1.NNCc1ccccc1.
What is the InChIKey of benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine?
The InChIKey is KVNUKTRFHQOCNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO.C7H10N2/c9-8(10,11)13-7-3-1-6(5-12)2-4-7;8-9-6-7-4-2-1-3-5-7/h1-4H,5,12H2;1-5,9H,6,8H2.
What are the key properties of benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine?
benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine has a molecular weight of 313.32 g/mol, XLogP of 2.69, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylhydrazine;[4-(trifluoromethoxy)phenyl]methanamine is sourced from PubChem (CID 159253031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).