C11H9F3N4O — CID 22326853
5-[3-(trifluoromethoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 22326853) has the molecular formula C11H9F3N4O and a molecular weight of 270.21 g/mol. Its IUPAC name is 5-[3-(trifluoromethoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[3-(trifluoromethoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22326853 |
| Molecular Formula | C11H9F3N4O |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-[3-(trifluoromethoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cccc(OC(F)(F)F)c2)c(N)n1 |
| InChI | InChI=1S/C11H9F3N4O/c12-11(13,14)19-7-3-1-2-6(4-7)8-5-17-10(16)18-9(8)15/h1-5H,(H4,15,16,17,18) |
| InChIKey | PETCWXJBRFCBAA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |