C10H7F3N2O2 — CID 121231645
5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine (PubChem CID 121231645) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine.
| Compound Name | 5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 121231645 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-[3-(trifluoromethoxy)phenyl]-1,3-oxazol-2-amine |
| SMILES | Nc1ncc(-c2cccc(OC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)17-7-3-1-2-6(4-7)8-5-15-9(14)16-8/h1-5H,(H2,14,15) |
| InChIKey | JSAZBPGJJJHPNV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |