C15H12N2O — CID 82291590
5-(4-phenylphenyl)-1,3-oxazol-2-amine (PubChem CID 82291590) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-1,3-oxazol-2-amine.
| Compound Name | 5-(4-phenylphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 82291590 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5-(4-phenylphenyl)-1,3-oxazol-2-amine |
| SMILES | Nc1ncc(-c2ccc(-c3ccccc3)cc2)o1 |
| InChI | InChI=1S/C15H12N2O/c16-15-17-10-14(18-15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10H,(H2,16,17) |
| InChIKey | HHHJHVFGBYINKG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |