C12H12ClNO — CID 10353470
2-(3-chloropropyl)-5-phenyl-1,3-oxazole (PubChem CID 10353470) has the molecular formula C12H12ClNO and a molecular weight of 221.69 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-phenyl-1,3-oxazole.
| Compound Name | 2-(3-chloropropyl)-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 10353470 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-(3-chloropropyl)-5-phenyl-1,3-oxazole |
| SMILES | ClCCCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H12ClNO/c13-8-4-7-12-14-9-11(15-12)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | WQRIJGJOONZBJI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|