C11H8N2O — CID 12639620
2-(5-phenyl-1,3-oxazol-2-yl)acetonitrile (PubChem CID 12639620) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-(5-phenyl-1,3-oxazol-2-yl)acetonitrile.
| Compound Name | 2-(5-phenyl-1,3-oxazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 12639620 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-(5-phenyl-1,3-oxazol-2-yl)acetonitrile |
| SMILES | N#CCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C11H8N2O/c12-7-6-11-13-8-10(14-11)9-4-2-1-3-5-9/h1-5,8H,6H2 |
| InChIKey | HQPRFQMTHNXKMD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |