C17H15NO — CID 135058309
2-benzyl-5-(4-methylphenyl)-1,3-oxazole (PubChem CID 135058309) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-benzyl-5-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 2-benzyl-5-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 135058309 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-benzyl-5-(4-methylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(-c2cnc(Cc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C17H15NO/c1-13-7-9-15(10-8-13)16-12-18-17(19-16)11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3 |
| InChIKey | MXJIBAYEFQUPEA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |